ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50907-31-8 5-(2,6-Dichlorophenyl)-1H-tetrazole |
|
| Naam product | 5-(2,6-Dichlorophenyl)-1H-tetrazole |
| Engelse naam | 5-(2,6-Dichlorophenyl)-1H-tetrazole;5-(2-Fluorophenyl)-1H-tetrazole;5-(2,6-dichlorophenyl)-2H-tetrazole |
| MF | C7H4Cl2N4 |
| Molecuulgewicht | 215.0395 |
| InChI | InChI=1/C7H4Cl2N4/c8-4-2-1-3-5(9)6(4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
| CAS-nummer | 50907-31-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.574g/cm3 |
| Kookpunt | 399.9°C at 760 mmHg |
| Brekingsindex | 1.641 |
| Vlampunt | 227.9°C |
| Dampdruk | 1.32E-06mmHg at 25°C |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |