ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51069-11-5 4-Phenylquinuclidine |
|
| Nome del prodotto | 4-Phenylquinuclidine |
| Nome inglese | 4-Phenylquinuclidine;4-Phenyl-1-azabicyclo[2.2.2]octane |
| Formula molecolare | C13H17N |
| Peso Molecolare | 187.2808 |
| InChI | InChI=1/C13H17N/c1-2-4-12(5-3-1)13-6-9-14(10-7-13)11-8-13/h1-5H,6-11H2 |
| Numero CAS | 51069-11-5 |
| Struttura molecolare | ![]() |
| Densità | 1.07g/cm3 |
| Punto di ebollizione | 276.1°C at 760 mmHg |
| Indice di rifrazione | 1.59 |
| Punto d'infiammabilità | 110.4°C |
| Pressione di vapore | 0.00489mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |