ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51069-11-5 4-Phenylquinuclidine |
|
| produktnavn | 4-Phenylquinuclidine |
| Engelsk navn | 4-Phenylquinuclidine;4-Phenyl-1-azabicyclo[2.2.2]octane |
| Molekylær Formel | C13H17N |
| Molekylvekt | 187.2808 |
| InChI | InChI=1/C13H17N/c1-2-4-12(5-3-1)13-6-9-14(10-7-13)11-8-13/h1-5H,6-11H2 |
| CAS-nummer | 51069-11-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.07g/cm3 |
| Kokepunkt | 276.1°C at 760 mmHg |
| Brytningsindeks | 1.59 |
| Flammepunktet | 110.4°C |
| Damptrykk | 0.00489mmHg at 25°C |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |