ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52372-96-0 4-methoxy-2,3-dihydro-1H-inden-1-amine |
|
| Nome del prodotto | 4-methoxy-2,3-dihydro-1H-inden-1-amine |
| Nome inglese | 4-methoxy-2,3-dihydro-1H-inden-1-amine;1H-inden-1-amine, 2,3-dihydro-4-methoxy-;2,3-Dihydro-4-methoxy-1H-inden-1-amine |
| Formula molecolare | C10H13NO |
| Peso Molecolare | 163.2163 |
| InChI | InChI=1/C10H13NO/c1-12-10-4-2-3-7-8(10)5-6-9(7)11/h2-4,9H,5-6,11H2,1H3 |
| Numero CAS | 52372-96-0 |
| Struttura molecolare | ![]() |
| Densità | 1.087g/cm3 |
| Punto di ebollizione | 276°C at 760 mmHg |
| Indice di rifrazione | 1.561 |
| Punto d'infiammabilità | 126.9°C |
| Pressione di vapore | 0.00492mmHg at 25°C |
| MSDS | |