ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52372-96-0 4-methoxy-2,3-dihydro-1H-inden-1-amine |
|
| Nome do produto | 4-methoxy-2,3-dihydro-1H-inden-1-amine |
| Nome em inglês | 4-methoxy-2,3-dihydro-1H-inden-1-amine;1H-inden-1-amine, 2,3-dihydro-4-methoxy-;2,3-Dihydro-4-methoxy-1H-inden-1-amine |
| Fórmula molecular | C10H13NO |
| Peso Molecular | 163.2163 |
| InChI | InChI=1/C10H13NO/c1-12-10-4-2-3-7-8(10)5-6-9(7)11/h2-4,9H,5-6,11H2,1H3 |
| CAS Registry Number | 52372-96-0 |
| Estrutura Molecular | ![]() |
| Densidade | 1.087g/cm3 |
| Ponto de ebulição | 276°C at 760 mmHg |
| índice de refração | 1.561 |
| O ponto de inflamação | 126.9°C |
| Pressão de vapor | 0.00492mmHg at 25°C |
| MSDS | |