ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54839-22-4 4-Chlorobutyric acid phenyl ester |
|
| Nome del prodotto | 4-Chlorobutyric acid phenyl ester |
| Nome inglese | 4-Chlorobutyric acid phenyl ester;Phenyl 4-chlorobutyrate;phenyl 4-chlorobutanoate |
| Formula molecolare | C10H11ClO2 |
| Peso Molecolare | 198.6461 |
| InChI | InChI=1/C10H11ClO2/c11-8-4-7-10(12)13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| Numero CAS | 54839-22-4 |
| EINECS | 259-369-3 |
| Struttura molecolare | ![]() |
| Densità | 1.158g/cm3 |
| Punto di ebollizione | 293.2°C at 760 mmHg |
| Indice di rifrazione | 1.515 |
| Punto d'infiammabilità | 143.7°C |
| Pressione di vapore | 0.00175mmHg at 25°C |
| MSDS | |