ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54839-22-4 4-Chlorobutyric acid phenyl ester |
|
| Naam product | 4-Chlorobutyric acid phenyl ester |
| Engelse naam | 4-Chlorobutyric acid phenyl ester;Phenyl 4-chlorobutyrate;phenyl 4-chlorobutanoate |
| MF | C10H11ClO2 |
| Molecuulgewicht | 198.6461 |
| InChI | InChI=1/C10H11ClO2/c11-8-4-7-10(12)13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| CAS-nummer | 54839-22-4 |
| EINECS | 259-369-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.158g/cm3 |
| Kookpunt | 293.2°C at 760 mmHg |
| Brekingsindex | 1.515 |
| Vlampunt | 143.7°C |
| Dampdruk | 0.00175mmHg at 25°C |
| MSDS | |