ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55792-37-5 4-Heptyloxyphenyl isocyanate |
|
| Nome del prodotto | 4-Heptyloxyphenyl isocyanate |
| Nome inglese | 4-Heptyloxyphenyl isocyanate;1-(Heptyloxy)-4-isocyanatobenzene;Benzene, 1-(heptyloxy)-4-isocyanato-;Heptyl 4-isocyanatophenyl ether |
| Formula molecolare | C14H19NO2 |
| Peso Molecolare | 233.3062 |
| InChI | InChI=1/C14H19NO2/c1-2-3-4-5-6-11-17-14-9-7-13(8-10-14)15-12-16/h7-10H,2-6,11H2,1H3 |
| Numero CAS | 55792-37-5 |
| Struttura molecolare | ![]() |
| Densità | 0.98g/cm3 |
| Punto di ebollizione | 324.4°C at 760 mmHg |
| Indice di rifrazione | 1.499 |
| Punto d'infiammabilità | 125.4°C |
| Pressione di vapore | 0.000246mmHg at 25°C |
| MSDS | |