ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55792-37-5 4-Heptyloxyphenyl isocyanate |
|
| 상품명칭 | 4-Heptyloxyphenyl isocyanate |
| 영문 이름 | 4-Heptyloxyphenyl isocyanate;1-(Heptyloxy)-4-isocyanatobenzene;Benzene, 1-(heptyloxy)-4-isocyanato-;Heptyl 4-isocyanatophenyl ether |
| 분자식 | C14H19NO2 |
| 분자량 | 233.3062 |
| InChI | InChI=1/C14H19NO2/c1-2-3-4-5-6-11-17-14-9-7-13(8-10-14)15-12-16/h7-10H,2-6,11H2,1H3 |
| cas번호 | 55792-37-5 |
| 분자 구조 | ![]() |
| 밀도 | 0.98g/cm3 |
| 비등점 | 324.4°C at 760 mmHg |
| 굴절 지수 | 1.499 |
| 인화점 | 125.4°C |
| 증기압 | 0.000246mmHg at 25°C |
| MSDS | |