ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-02-7 1-Phenylnaphthalene |
|
| Nome del prodotto | 1-Phenylnaphthalene |
| Nome inglese | 1-Phenylnaphthalene;NSC 5257;Naphthalene, 1-phenyl-;Naphthalene, 1-phenyl- (8CI)(9CI) |
| Formula molecolare | C16H12 |
| Peso Molecolare | 204.2665 |
| InChI | InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| Numero CAS | 605-02-7 |
| EINECS | 210-081-6 |
| Struttura molecolare | ![]() |
| Densità | 1.081g/cm3 |
| Punto di ebollizione | 336.4°C at 760 mmHg |
| Indice di rifrazione | 1.647 |
| Punto d'infiammabilità | 148.2°C |
| Pressione di vapore | 0.000219mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |