ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-02-7 1-Phenylnaphthalene |
|
| Naam product | 1-Phenylnaphthalene |
| Engelse naam | 1-Phenylnaphthalene;NSC 5257;Naphthalene, 1-phenyl-;Naphthalene, 1-phenyl- (8CI)(9CI) |
| MF | C16H12 |
| Molecuulgewicht | 204.2665 |
| InChI | InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| CAS-nummer | 605-02-7 |
| EINECS | 210-081-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.081g/cm3 |
| Kookpunt | 336.4°C at 760 mmHg |
| Brekingsindex | 1.647 |
| Vlampunt | 148.2°C |
| Dampdruk | 0.000219mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |