ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-21-8 2-methylquinolin-6-ol |
|
| Nome del prodotto | 2-methylquinolin-6-ol |
| Nome inglese | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
| Formula molecolare | C10H9NO |
| Peso Molecolare | 159.1846 |
| InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
| Numero CAS | 613-21-8 |
| Struttura molecolare | ![]() |
| Densità | 1.21g/cm3 |
| Punto di fusione | 198℃ |
| Punto di ebollizione | 304.5°C at 760 mmHg |
| Indice di rifrazione | 1.666 |
| Punto d'infiammabilità | 142.3°C |
| Pressione di vapore | 0.000483mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |