ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-21-8 2-methylquinolin-6-ol |
|
| produktnavn | 2-methylquinolin-6-ol |
| Engelsk navn | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
| Molekylær Formel | C10H9NO |
| Molekylvekt | 159.1846 |
| InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
| CAS-nummer | 613-21-8 |
| Molecular Structure | ![]() |
| Tetthet | 1.21g/cm3 |
| Smeltepunkt | 198℃ |
| Kokepunkt | 304.5°C at 760 mmHg |
| Brytningsindeks | 1.666 |
| Flammepunktet | 142.3°C |
| Damptrykk | 0.000483mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |