ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-22-3 2,3,4,5,6-pentabromoethylbenzene |
|
| Nome del prodotto | 2,3,4,5,6-pentabromoethylbenzene |
| Nome inglese | 2,3,4,5,6-pentabromoethylbenzene;2,3,4,5,6-Pentabromoethylbenzene;3-05-00-00801 (Beilstein Handbook Reference);BRN 3133073;CCRIS 4852;EB 80;Pentabromoethylbenzene;Benzene, 1,2,3,4,5-pentabromo-6-ethyl-;Benzene, pentabromoethyl-;1,2,3,4,5-pentabromo-6-ethylbenzene |
| Formula molecolare | C8H5Br5 |
| Peso Molecolare | 500.6453 |
| InChI | InChI=1/C8H5Br5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H2,1H3 |
| Numero CAS | 85-22-3 |
| EINECS | 201-593-0 |
| Struttura molecolare | ![]() |
| Densità | 2.464g/cm3 |
| Punto di ebollizione | 413.3°C at 760 mmHg |
| Indice di rifrazione | 1.651 |
| Punto d'infiammabilità | 197.2°C |
| Pressione di vapore | 1.17E-06mmHg at 25°C |
| MSDS | |