ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-22-3 2,3,4,5,6-pentabromoethylbenzene |
|
| Nome do produto | 2,3,4,5,6-pentabromoethylbenzene |
| Nome em inglês | 2,3,4,5,6-pentabromoethylbenzene;2,3,4,5,6-Pentabromoethylbenzene;3-05-00-00801 (Beilstein Handbook Reference);BRN 3133073;CCRIS 4852;EB 80;Pentabromoethylbenzene;Benzene, 1,2,3,4,5-pentabromo-6-ethyl-;Benzene, pentabromoethyl-;1,2,3,4,5-pentabromo-6-ethylbenzene |
| Fórmula molecular | C8H5Br5 |
| Peso Molecular | 500.6453 |
| InChI | InChI=1/C8H5Br5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H2,1H3 |
| CAS Registry Number | 85-22-3 |
| EINECS | 201-593-0 |
| Estrutura Molecular | ![]() |
| Densidade | 2.464g/cm3 |
| Ponto de ebulição | 413.3°C at 760 mmHg |
| índice de refração | 1.651 |
| O ponto de inflamação | 197.2°C |
| Pressão de vapor | 1.17E-06mmHg at 25°C |
| MSDS | |