ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-12-4 thenalidine |
|
| Nome del prodotto | thenalidine |
| Nome inglese | thenalidine;N-(1-methyl-4-piperidyl)-N-(2-thenyl)aniline;1-methyl-N-phenyl-N-(thiophen-2-ylmethyl)piperidin-4-amine |
| Formula molecolare | C17H22N2S |
| Peso Molecolare | 286.435 |
| InChI | InChI=1/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3 |
| Numero CAS | 86-12-4 |
| EINECS | 201-651-5 |
| Struttura molecolare | ![]() |
| Densità | 1.14g/cm3 |
| Punto di ebollizione | 413.9°C at 760 mmHg |
| Indice di rifrazione | 1.619 |
| Punto d'infiammabilità | 204.1°C |
| Pressione di vapore | 4.64E-07mmHg at 25°C |
| MSDS | |