ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-12-4 thenalidine |
|
| produktnavn | thenalidine |
| Engelsk navn | thenalidine;N-(1-methyl-4-piperidyl)-N-(2-thenyl)aniline;1-methyl-N-phenyl-N-(thiophen-2-ylmethyl)piperidin-4-amine |
| Molekylær Formel | C17H22N2S |
| Molekylvekt | 286.435 |
| InChI | InChI=1/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3 |
| CAS-nummer | 86-12-4 |
| EINECS | 201-651-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.14g/cm3 |
| Kokepunkt | 413.9°C at 760 mmHg |
| Brytningsindeks | 1.619 |
| Flammepunktet | 204.1°C |
| Damptrykk | 4.64E-07mmHg at 25°C |
| MSDS | |