ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
939-52-6 p-Chlorobutyrophenone |
|
Nome del prodotto | p-Chlorobutyrophenone |
Nome inglese | p-Chlorobutyrophenone;4-chlorobutylphenone |
Formula molecolare | C10H11ClO |
Peso Molecolare | 182.64 |
InChI | InChI=1/C10H11ClO/c1-2-3-10(12)8-4-6-9(11)7-5-8/h4-7H,2-3H2,1H3 |
Numero CAS | 939-52-6 |
EINECS | 213-362-1 |
Struttura molecolare | ![]() |
Densità | 1.14 |
Punto di fusione | 35-37℃ |
Punto di ebollizione | 130℃(4 torr) |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |