ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
939-52-6 p-Chlorobutyrophenone |
|
Nama produk | p-Chlorobutyrophenone |
Nama Inggeris | p-Chlorobutyrophenone;4-chlorobutylphenone |
MF | C10H11ClO |
Berat Molekul | 182.64 |
InChI | InChI=1/C10H11ClO/c1-2-3-10(12)8-4-6-9(11)7-5-8/h4-7H,2-3H2,1H3 |
CAS NO | 939-52-6 |
EINECS | 213-362-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.14 |
Titik lebur | 35-37℃ |
Titik didih | 130℃(4 torr) |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |