ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-20-7 D-Trehalose anhydrous |
|
| Nome del prodotto | D-Trehalose anhydrous |
| Nome inglese | D-Trehalose anhydrous;Trehalose;alpha-D-Trehalose;alpha-D-glucopyranosyl alpha-D-glucopyranoside;Trehalose;D(+)Trehalose;D-(+)-Trehalose;α-L-glucopyranosyl;α-D-glucopyranoside;Trehalose anhydrous |
| Formula molecolare | C12H22O11 |
| Peso Molecolare | 342.2965 |
| InChI | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| Numero CAS | 99-20-7 |
| EINECS | 202-739-6 |
| Struttura molecolare | ![]() |
| Densità | 1.76g/cm3 |
| Punto di fusione | 214-216℃ |
| Punto di ebollizione | 675.4°C at 760 mmHg |
| Indice di rifrazione | 1.652 |
| Punto d'infiammabilità | 362.3°C |
| Pressione di vapore | 3.87E-21mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |