ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-20-7 D-Trehalose anhydrous |
|
| Ürün Adı | D-Trehalose anhydrous |
| ingilizce adı | D-Trehalose anhydrous;Trehalose;alpha-D-Trehalose;alpha-D-glucopyranosyl alpha-D-glucopyranoside;Trehalose;D(+)Trehalose;D-(+)-Trehalose;α-L-glucopyranosyl;α-D-glucopyranoside;Trehalose anhydrous |
| Moleküler Formülü | C12H22O11 |
| Molekül Ağırlığı | 342.2965 |
| InChI | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| CAS kayıt numarası | 99-20-7 |
| EINECS | 202-739-6 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.76g/cm3 |
| Ergime noktası | 214-216℃ |
| Kaynama noktası | 675.4°C at 760 mmHg |
| Kırılma indisi | 1.652 |
| Alevlenme noktası | 362.3°C |
| Buhar basıncı | 3.87E-21mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |