Chemindex > 107535-73-9
KR ▼
107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride |
|
| 상품명칭 | 2,3,5,6-Tetrafluorobenzoyl chloride |
| 영문 이름 | 2,3,5,6-Tetrafluorobenzoyl chloride; |
| 분자식 | C7HClF4O |
| 분자량 | 212.5289 |
| InChI | InChI=1/C7HClF4O/c8-7(13)4-5(11)2(9)1-3(10)6(4)12/h1H |
| cas번호 | 107535-73-9 |
| 분자 구조 |  |
| 밀도 | 1.601g/cm3 |
| 비등점 | 172.1°C at 760 mmHg |
| 굴절 지수 | 1.461 |
| 인화점 | 57.9°C |
| 증기압 | 1.35mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 