ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride |
|
Nama produk | 2,3,5,6-Tetrafluorobenzoyl chloride |
Nama Inggeris | 2,3,5,6-Tetrafluorobenzoyl chloride; |
MF | C7HClF4O |
Berat Molekul | 212.5289 |
InChI | InChI=1/C7HClF4O/c8-7(13)4-5(11)2(9)1-3(10)6(4)12/h1H |
CAS NO | 107535-73-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.601g/cm3 |
Titik didih | 172.1°C at 760 mmHg |
Indeks bias | 1.461 |
Titik nyala | 57.9°C |
Tekanan wap | 1.35mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |