ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
192702-01-5 3-Chloro-4-fluorobenzyl bromide |
|
상품명칭 | 3-Chloro-4-fluorobenzyl bromide |
영문 이름 | 3-Chloro-4-fluorobenzyl bromide;alpha-Bromo-3-chloro-4-fluorotoluene;4-(bromomethyl)-2-chloro-1-fluorobenzene |
분자식 | C7H5BrClF |
분자량 | 223.47 |
InChI | InChI=1/C7H5BrClF/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
cas번호 | 192702-01-5 |
분자 구조 | ![]() |
밀도 | 1.654g/cm3 |
비등점 | 235°C at 760 mmHg |
굴절 지수 | 1.561 |
인화점 | 95.9°C |
증기압 | 0.0784mmHg at 25°C |
리스크 규칙 | R34##Causes burns.||R36##Irritating to eyes.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |