ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
192702-01-5 3-Chloro-4-fluorobenzyl bromide |
|
Naam product | 3-Chloro-4-fluorobenzyl bromide |
Engelse naam | 3-Chloro-4-fluorobenzyl bromide;alpha-Bromo-3-chloro-4-fluorotoluene;4-(bromomethyl)-2-chloro-1-fluorobenzene |
MF | C7H5BrClF |
Molecuulgewicht | 223.47 |
InChI | InChI=1/C7H5BrClF/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
CAS-nummer | 192702-01-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.654g/cm3 |
Kookpunt | 235°C at 760 mmHg |
Brekingsindex | 1.561 |
Vlampunt | 95.9°C |
Dampdruk | 0.0784mmHg at 25°C |
Risico-codes | R34##Causes burns.||R36##Irritating to eyes.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |