Chemindex > 233585-04-1
KR ▼
233585-04-1 2,6-디하이드록시-3-니트로벤조니트릴 |
|
| 상품명칭 | 2,6-디하이드록시-3-니트로벤조니트릴 |
| 영문 이름 | 2,6-dihydroxy-3-nitrobenzonitrile; |
| 분자식 | C7H4N2O4 |
| 분자량 | 180.1177 |
| InChI | InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
| cas번호 | 233585-04-1 |
| 분자 구조 |  |
| 밀도 | 1.69g/cm3 |
| 녹는 점 | 238℃ |
| 비등점 | 358.2°C at 760 mmHg |
| 굴절 지수 | 1.683 |
| 인화점 | 170.5°C |
| 증기압 | 1.25E-05mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 