ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile |
|
Nama produk | 2,6-dihydroxy-3-nitrobenzonitrile |
Nama Inggeris | 2,6-dihydroxy-3-nitrobenzonitrile; |
MF | C7H4N2O4 |
Berat Molekul | 180.1177 |
InChI | InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
CAS NO | 233585-04-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.69g/cm3 |
Titik lebur | 238℃ |
Titik didih | 358.2°C at 760 mmHg |
Indeks bias | 1.683 |
Titik nyala | 170.5°C |
Tekanan wap | 1.25E-05mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |