Chemindex > 306936-71-0
KR ▼
306936-71-0 3- 메틸 -5- (5- 메틸 이소 옥사 졸 -3- 일) 이소 옥사 졸 -4- 카르 보닐 클로라이드 |
|
| 상품명칭 | 3- 메틸 -5- (5- 메틸 이소 옥사 졸 -3- 일) 이소 옥사 졸 -4- 카르 보닐 클로라이드 |
| 별명 | 3', 5- 디메틸 -3,5'- 비 이소 옥사 졸 -4'- 카르 보닐 클로라이드; |
| 영문 이름 | 3-methyl-5-(5-methylisoxazol-3-yl)isoxazol-4-carbonylchloride;3',5-dimethyl-3,5'-biisoxazole-4'-carbonyl chloride |
| 분자식 | C9H7ClN2O3 |
| 분자량 | 226.6165 |
| InChI | InChI=1/C9H7ClN2O3/c1-4-3-6(12-14-4)8-7(9(10)13)5(2)11-15-8/h3H,1-2H3 |
| cas번호 | 306936-71-0 |
| 분자 구조 |  |
| 밀도 | 1.367g/cm3 |
| 녹는 점 | 57℃ |
| 비등점 | 400°C at 760 mmHg |
| 굴절 지수 | 1.534 |
| 인화점 | 195.7°C |
| 증기압 | 1.31E-06mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
306936-71-0 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 