Chemindex >306936-71-0
MY ▼
306936-71-0 3-methyl-5-(5-methylisoxazol-3-yl)isoxazol-4-carbonylchloride |
|
| Nama produk | 3-methyl-5-(5-methylisoxazol-3-yl)isoxazol-4-carbonylchloride |
| Sinonim | 3',5-dimethyl-3,5'-biisoxazole-4'-karbonil klorida; |
| Nama Inggeris | 3-methyl-5-(5-methylisoxazol-3-yl)isoxazol-4-carbonylchloride;3',5-dimethyl-3,5'-biisoxazole-4'-carbonyl chloride |
| MF | C9H7ClN2O3 |
| Berat Molekul | 226.6165 |
| InChI | InChI=1/C9H7ClN2O3/c1-4-3-6(12-14-4)8-7(9(10)13)5(2)11-15-8/h3H,1-2H3 |
| CAS NO | 306936-71-0 |
| Struktur Molekul |  |
| Kepadatan | 1.367g/cm3 |
| Titik lebur | 57℃ |
| Titik didih | 400°C at 760 mmHg |
| Indeks bias | 1.534 |
| Titik nyala | 195.7°C |
| Tekanan wap | 1.31E-06mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 306936-71-0 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 