ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-36-8 5-(2-티에닐)니코티노일 클로라이드 하이드로클로라이드 |
|
상품명칭 | 5-(2-티에닐)니코티노일 클로라이드 하이드로클로라이드 |
별명 | 5-티오펜-2-일피리딘-3-카르보닐 클로라이드 하이드로클로라이드; 5-티오펜-2-일피리딘-3-카르보닐 클로라이드; |
영문 이름 | 5-(2-thienyl)nicotinoyl chloride hydrochloride;5-thiophen-2-ylpyridine-3-carbonyl chloride hydrochloride;5-thiophen-2-ylpyridine-3-carbonyl chloride |
분자식 | C10H6ClNOS |
분자량 | 223.6787 |
InChI | InChI=1/C10H6ClNOS/c11-10(13)8-4-7(5-12-6-8)9-2-1-3-14-9/h1-6H |
cas번호 | 321309-36-8 |
분자 구조 | ![]() |
밀도 | 1.365g/cm3 |
녹는 점 | 215℃ |
비등점 | 366.8°C at 760 mmHg |
굴절 지수 | 1.62 |
인화점 | 175.6°C |
증기압 | 1.43E-05mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |