ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-36-8 5-(2-thienyl)nikotinoyl klorida hidroklorida |
|
Nama produk | 5-(2-thienyl)nikotinoyl klorida hidroklorida |
Sinonim | 5-thiophen-2-ylpyridine-3-carbonyl chloride hydrochloride; 5-thiophen-2-ylpyridine-3-karbonil klorida; |
Nama Inggeris | 5-(2-thienyl)nicotinoyl chloride hydrochloride;5-thiophen-2-ylpyridine-3-carbonyl chloride hydrochloride;5-thiophen-2-ylpyridine-3-carbonyl chloride |
MF | C10H6ClNOS |
Berat Molekul | 223.6787 |
InChI | InChI=1/C10H6ClNOS/c11-10(13)8-4-7(5-12-6-8)9-2-1-3-14-9/h1-6H |
CAS NO | 321309-36-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.365g/cm3 |
Titik lebur | 215℃ |
Titik didih | 366.8°C at 760 mmHg |
Indeks bias | 1.62 |
Titik nyala | 175.6°C |
Tekanan wap | 1.43E-05mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |