Chemindex > 374538-00-8
KR ▼
374538-00-8 3-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester |
|
| 상품명칭 | 3-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester |
| 영문 이름 | 3-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester;2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane |
| 분자식 | C11H15BBrNO2 |
| 분자량 | 283.9573 |
| InChI | InChI=1/C11H15BBrNO2/c1-14-5-7-15-12(16-8-6-14)10-3-2-4-11(13)9-10/h2-4,9H,5-8H2,1H3 |
| cas번호 | 374538-00-8 |
| 분자 구조 |  |
| 밀도 | 1.368g/cm3 |
| 비등점 | 374.758°C at 760 mmHg |
| 굴절 지수 | 1.553 |
| 인화점 | 180.448°C |
| 증기압 | 0mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
374538-00-8 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 