ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
374538-00-8 3-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester |
|
اسم المنتج | 3-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester |
الاسم بالانجليزية | 3-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester;2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane |
الصيغة الجزيئية | C11H15BBrNO2 |
الوزن الجزيئي الغرامي | 283.9573 |
InChI | InChI=1/C11H15BBrNO2/c1-14-5-7-15-12(16-8-6-14)10-3-2-4-11(13)9-10/h2-4,9H,5-8H2,1H3 |
إستراتيجية المساعدة القطرية | 374538-00-8 |
بنية جزيئية | ![]() |
كثافة | 1.368g/cm3 |
نقطة الغليان | 374.758°C at 760 mmHg |
معامل الإنكسار | 1.553 |
نقطة الوميض | 180.448°C |
ضغط البخار | 0mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |