Chemindex > 499770-67-1
KR ▼
499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
|
| 상품명칭 | 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
| 영문 이름 | 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde;1-methyl-1H-benzo[d][1,2,3]triazole-5-carbaldehyde;1-methylbenzotriazole-5-carbaldehyde |
| 분자식 | C8H7N3O |
| 분자량 | 161.1607 |
| InChI | InChI=1/C8H7N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-5H,1H3 |
| cas번호 | 499770-67-1 |
| 분자 구조 |  |
| 밀도 | 1.333g/cm3 |
| 녹는 점 | 159℃ |
| 비등점 | 354.124°C at 760 mmHg |
| 굴절 지수 | 1.668 |
| 인화점 | 167.968°C |
| 증기압 | 0mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 