ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
|
Ürün Adı | 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
ingilizce adı | 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde;1-methyl-1H-benzo[d][1,2,3]triazole-5-carbaldehyde;1-methylbenzotriazole-5-carbaldehyde |
Moleküler Formülü | C8H7N3O |
Molekül Ağırlığı | 161.1607 |
InChI | InChI=1/C8H7N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-5H,1H3 |
CAS kayıt numarası | 499770-67-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.333g/cm3 |
Ergime noktası | 159℃ |
Kaynama noktası | 354.124°C at 760 mmHg |
Kırılma indisi | 1.668 |
Alevlenme noktası | 167.968°C |
Buhar basıncı | 0mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |