ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501014-45-5 2-(9H-Carbazolyl)ethylboronic acid diethanolamine cyclic ester |
|
상품명칭 | 2-(9H-Carbazolyl)ethylboronic acid diethanolamine cyclic ester |
영문 이름 | 2-(9H-Carbazolyl)ethylboronic acid diethanolamine cyclic ester;9-[2-(1,3,6,2-dioxazaborocan-2-yl)ethyl]-9H-carbazole |
분자식 | C18H21BN2O2 |
분자량 | 308.1825 |
InChI | InChI=1/C18H21BN2O2/c1-3-7-17-15(5-1)16-6-2-4-8-18(16)21(17)12-9-19-22-13-10-20-11-14-23-19/h1-8,20H,9-14H2 |
cas번호 | 501014-45-5 |
분자 구조 | ![]() |
밀도 | 1.177g/cm3 |
비등점 | 432.963°C at 760 mmHg |
굴절 지수 | 1.603 |
인화점 | 215.648°C |
증기압 | 0mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |