ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501014-45-5 2-(9H-Carbazolyl)ethylboronic acid diethanolamine cyclic ester |
|
Naam product | 2-(9H-Carbazolyl)ethylboronic acid diethanolamine cyclic ester |
Engelse naam | 2-(9H-Carbazolyl)ethylboronic acid diethanolamine cyclic ester;9-[2-(1,3,6,2-dioxazaborocan-2-yl)ethyl]-9H-carbazole |
MF | C18H21BN2O2 |
Molecuulgewicht | 308.1825 |
InChI | InChI=1/C18H21BN2O2/c1-3-7-17-15(5-1)16-6-2-4-8-18(16)21(17)12-9-19-22-13-10-20-11-14-23-19/h1-8,20H,9-14H2 |
CAS-nummer | 501014-45-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.177g/cm3 |
Kookpunt | 432.963°C at 760 mmHg |
Brekingsindex | 1.603 |
Vlampunt | 215.648°C |
Dampdruk | 0mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |