ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53744-28-8 3,4-Dimethoxychalcone |
|
상품명칭 | 3,4-Dimethoxychalcone |
영문 이름 | 3,4-Dimethoxychalcone;3,4-Dimethoxybenzylideneacetophenone;(2E)-3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one |
분자식 | C17H16O3 |
분자량 | 268.3071 |
InChI | InChI=1/C17H16O3/c1-19-16-11-9-13(12-17(16)20-2)8-10-15(18)14-6-4-3-5-7-14/h3-12H,1-2H3/b10-8+ |
cas번호 | 53744-28-8 |
분자 구조 | ![]() |
밀도 | 1.128g/cm3 |
비등점 | 421.8°C at 760 mmHg |
굴절 지수 | 1.591 |
인화점 | 200.7°C |
증기압 | 2.53E-07mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |