ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53744-28-8 3,4-Dimethoxychalcone |
|
produktnavn | 3,4-Dimethoxychalcone |
Engelsk navn | 3,4-Dimethoxychalcone;3,4-Dimethoxybenzylideneacetophenone;(2E)-3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one |
Molekylær Formel | C17H16O3 |
Molekylvekt | 268.3071 |
InChI | InChI=1/C17H16O3/c1-19-16-11-9-13(12-17(16)20-2)8-10-15(18)14-6-4-3-5-7-14/h3-12H,1-2H3/b10-8+ |
CAS-nummer | 53744-28-8 |
Molecular Structure | ![]() |
Tetthet | 1.128g/cm3 |
Kokepunkt | 421.8°C at 760 mmHg |
Brytningsindeks | 1.591 |
Flammepunktet | 200.7°C |
Damptrykk | 2.53E-07mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |