ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54571-68-5 5-옥소-L-프롤린, 트리메틸아민과 화합물(1:1) |
|
| 상품명칭 | 5-옥소-L-프롤린, 트리메틸아민과 화합물(1:1) |
| 별명 | 5-Oxo-L-프롤린, 트리메틸아민과 화합물(1:1); 5-옥소-L-프롤린 - N,N-디메틸메타나민(1:1); |
| 영문 이름 | 5-oxo-L-proline, compound with trimethylamine (1:1);5-Oxo-L-proline, compound with trimethylamine (1:1);5-oxo-L-proline - N,N-dimethylmethanamine (1:1) |
| 분자식 | C8H16N2O3 |
| 분자량 | 188.2242 |
| InChI | InChI=1/C5H7NO3.C3H9N/c7-4-2-1-3(6-4)5(8)9;1-4(2)3/h3H,1-2H2,(H,6,7)(H,8,9);1-3H3/t3-;/m0./s1 |
| cas번호 | 54571-68-5 |
| EC번호 | 259-235-4 |
| 분자 구조 | ![]() |
| 비등점 | 453.1°C at 760 mmHg |
| 인화점 | 227.8°C |
| 증기압 | 1.79E-09mmHg at 25°C |
| MSDS | |