ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54571-68-5 5-oxo-L-proline, verbinding met trimethylamine (1:1) |
|
| Naam product | 5-oxo-L-proline, verbinding met trimethylamine (1:1) |
| Synoniemen | 5-Oxo-L-proline, verbinding met trimethylamine (1:1); 5-oxo-L-proline - N,N-dimethylmethanamine (1:1); |
| Engelse naam | 5-oxo-L-proline, compound with trimethylamine (1:1);5-Oxo-L-proline, compound with trimethylamine (1:1);5-oxo-L-proline - N,N-dimethylmethanamine (1:1) |
| MF | C8H16N2O3 |
| Molecuulgewicht | 188.2242 |
| InChI | InChI=1/C5H7NO3.C3H9N/c7-4-2-1-3(6-4)5(8)9;1-4(2)3/h3H,1-2H2,(H,6,7)(H,8,9);1-3H3/t3-;/m0./s1 |
| CAS-nummer | 54571-68-5 |
| EINECS | 259-235-4 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 453.1°C at 760 mmHg |
| Vlampunt | 227.8°C |
| Dampdruk | 1.79E-09mmHg at 25°C |
| MSDS | |