ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
616-39-7 N,N-Diethylmethylamine |
|
| 상품명칭 | N,N-Diethylmethylamine |
| 영문 이름 | N,N-Diethylmethylamine;N-Methyldiethylamine;Diethylmethylamine;N-ethyl-N-methylethanamine;N-ethyl-N-methylethanaminium |
| 분자식 | C5H14N |
| 분자량 | 88.1708 |
| InChI | InChI=1/C5H13N/c1-4-6(3)5-2/h4-5H2,1-3H3/p+1 |
| cas번호 | 616-39-7 |
| EC번호 | 210-480-5 |
| 분자 구조 | ![]() |
| 녹는 점 | -196℃ |
| 비등점 | 63.7°C at 760 mmHg |
| 증기압 | 169mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R11||R20/22||R34:; |
| 보안 규칙 | S16||S26||S36/37/39||S45:; |
| MSDS | |