ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
616-39-7 N,N-Diethylmethylamine |
|
| Nome do produto | N,N-Diethylmethylamine |
| Nome em inglês | N,N-Diethylmethylamine;N-Methyldiethylamine;Diethylmethylamine;N-ethyl-N-methylethanamine;N-ethyl-N-methylethanaminium |
| Fórmula molecular | C5H14N |
| Peso Molecular | 88.1708 |
| InChI | InChI=1/C5H13N/c1-4-6(3)5-2/h4-5H2,1-3H3/p+1 |
| CAS Registry Number | 616-39-7 |
| EINECS | 210-480-5 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | -196℃ |
| Ponto de ebulição | 63.7°C at 760 mmHg |
| Pressão de vapor | 169mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R11||R20/22||R34:; |
| Descrição da Segurança | S16||S26||S36/37/39||S45:; |
| MSDS | |