ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70421-98-6 3-(1-azabicyclo[2.2.2]oct-2-ylmethyl)-1H-indole hydrochloride |
|
| 상품명칭 | 3-(1-azabicyclo[2.2.2]oct-2-ylmethyl)-1H-indole hydrochloride |
| 영문 이름 | 3-(1-azabicyclo[2.2.2]oct-2-ylmethyl)-1H-indole hydrochloride; |
| 분자식 | C16H21ClN2 |
| 분자량 | 276.8043 |
| InChI | InChI=1/C16H20N2.ClH/c1-2-4-16-15(3-1)13(11-17-16)10-14-9-12-5-7-18(14)8-6-12;/h1-4,11-12,14,17H,5-10H2;1H |
| cas번호 | 70421-98-6 |
| 분자 구조 | ![]() |
| 비등점 | 409.1°C at 760 mmHg |
| 인화점 | 201.2°C |
| 증기압 | 6.66E-07mmHg at 25°C |
| MSDS | |