Chemindex > 769-40-4
KR ▼
769-40-4 2,3,5,6-tetrafluorothiophenol |
|
| 상품명칭 | 2,3,5,6-tetrafluorothiophenol |
| 영문 이름 | 2,3,5,6-tetrafluorothiophenol;2,3,5,6-Tetrafluorobenzenethiol;2,3,5,6-tetrafluorobenzenethiolate |
| 분자식 | C6HF4S |
| 분자량 | 181.1313 |
| InChI | InChI=1/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H/p-1 |
| cas번호 | 769-40-4 |
| EC번호 | 212-210-1 |
| 분자 구조 |  |
| 비등점 | 152.6°C at 760 mmHg |
| 인화점 | 48.3°C |
| 증기압 | 4.45mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R10##Flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 