Chemindex > 769-40-4
PL ▼
769-40-4 2,3,5,6-tetrafluorothiophenol |
|
| Nazwa produktu: | 2,3,5,6-tetrafluorothiophenol |
| Angielska nazwa | 2,3,5,6-tetrafluorothiophenol;2,3,5,6-Tetrafluorobenzenethiol;2,3,5,6-tetrafluorobenzenethiolate |
| MF | C6HF4S |
| Masie cząsteczkowej | 181.1313 |
| InChI | InChI=1/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H/p-1 |
| Nr CAS | 769-40-4 |
| EINECS | 212-210-1 |
| Struktury molekularnej |  |
| Temperatura wrzenia | 152.6°C at 760 mmHg |
| Temperatura zapłonu | 48.3°C |
| Ciśnienie pary | 4.45mmHg at 25°C |
| Symbole zagrożenia |  Xi##Irritant:; |
| Kody ryzyka | R10##Flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 