ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-25-2 Ethyl 2-Aminobenzoate |
|
| 상품명칭 | Ethyl 2-Aminobenzoate |
| 영문 이름 | Ethyl 2-Aminobenzoate;Fema 2421;ethyl anthranilate;ethyl o-aminobenzoate;anthranilic acid ethyl ester;2-(ethoxycarbonyl)aniline;2-amino-benzoicaciethylester;2-carboethoxyaniline;2-Aminobenzoic acid ethyl ester;Ethyl-o-aminobenzoate |
| 분자식 | C9H11NO2 |
| 분자량 | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2,10H2,1H3 |
| cas번호 | 87-25-2 |
| EC번호 | 201-735-1 |
| 분자 구조 | ![]() |
| 밀도 | 1.13g/cm3 |
| 비등점 | 264.7°C at 760 mmHg |
| 굴절 지수 | 1.554 |
| 인화점 | 126.5°C |
| 증기압 | 0.00954mmHg at 25°C |
| MSDS | |