ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-25-2 Ethyl 2-Aminobenzoate |
|
| produktnavn | Ethyl 2-Aminobenzoate |
| Engelsk navn | Ethyl 2-Aminobenzoate;Fema 2421;ethyl anthranilate;ethyl o-aminobenzoate;anthranilic acid ethyl ester;2-(ethoxycarbonyl)aniline;2-amino-benzoicaciethylester;2-carboethoxyaniline;2-Aminobenzoic acid ethyl ester;Ethyl-o-aminobenzoate |
| Molekylær Formel | C9H11NO2 |
| Molekylvekt | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2,10H2,1H3 |
| CAS-nummer | 87-25-2 |
| EINECS | 201-735-1 |
| Molecular Structure | ![]() |
| Tetthet | 1.13g/cm3 |
| Kokepunkt | 264.7°C at 760 mmHg |
| Brytningsindeks | 1.554 |
| Flammepunktet | 126.5°C |
| Damptrykk | 0.00954mmHg at 25°C |
| MSDS | |