ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88738-78-7 methyl P,P-bis(2,2,2-trifluoroethyl) phosphonoacetate |
|
상품명칭 | methyl P,P-bis(2,2,2-trifluoroethyl) phosphonoacetate |
영문 이름 | methyl P,P-bis(2,2,2-trifluoroethyl) phosphonoacetate;Methyl O,O-bis(2,2,2-trifluoroethyl)phosphonoacetate;Bis(2,2,2-trifluoroethyl) (methoxycarbonylmethyl)phosphonate;methyl [bis(2,2,2-trifluoroethoxy)phosphoryl]acetate;9H-fluoren-9-ylmethyl pentafluorophenyl carbonate;Bis(2,2,2-trifluoroethyl)(methoxycarbonylmethyl)phosphonate |
분자식 | C21H11F5O3 |
분자량 | 406.3023 |
InChI | InChI=1/C21H11F5O3/c22-15-16(23)18(25)20(19(26)17(15)24)29-21(27)28-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
cas번호 | 88738-78-7 |
분자 구조 | ![]() |
밀도 | 1.457g/cm3 |
비등점 | 472.6°C at 760 mmHg |
굴절 지수 | 1.567 |
인화점 | 231°C |
증기압 | 4.23E-09mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |