ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88738-78-7 methyl P,P-bis(2,2,2-trifluoroethyl) phosphonoacetate |
|
Ürün Adı | methyl P,P-bis(2,2,2-trifluoroethyl) phosphonoacetate |
ingilizce adı | methyl P,P-bis(2,2,2-trifluoroethyl) phosphonoacetate;Methyl O,O-bis(2,2,2-trifluoroethyl)phosphonoacetate;Bis(2,2,2-trifluoroethyl) (methoxycarbonylmethyl)phosphonate;methyl [bis(2,2,2-trifluoroethoxy)phosphoryl]acetate;9H-fluoren-9-ylmethyl pentafluorophenyl carbonate;Bis(2,2,2-trifluoroethyl)(methoxycarbonylmethyl)phosphonate |
Moleküler Formülü | C21H11F5O3 |
Molekül Ağırlığı | 406.3023 |
InChI | InChI=1/C21H11F5O3/c22-15-16(23)18(25)20(19(26)17(15)24)29-21(27)28-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
CAS kayıt numarası | 88738-78-7 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.457g/cm3 |
Kaynama noktası | 472.6°C at 760 mmHg |
Kırılma indisi | 1.567 |
Alevlenme noktası | 231°C |
Buhar basıncı | 4.23E-09mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |